C20H36O6Si — CID 24938357
dimethyl 2-[(Z)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]propanedioate (PubChem CID 24938357) has the molecular formula C20H36O6Si and a molecular weight of 400.59 g/mol. Its IUPAC name is dimethyl 2-[(Z)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(Z)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 24938357 |
| Molecular Formula | C20H36O6Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | dimethyl 2-[(Z)-3-acetyl-7-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(C)/C(=C/CCCO[Si](C)(C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C20H36O6Si/c1-14(17(18(22)24-6)19(23)25-7)16(15(2)21)12-10-11-13-26-27(8,9)20(3,4)5/h12,14,17H,10-11,13H2,1-9H3/b16-12- |
| InChIKey | XNBOALAODMLFJA-VBKFSLOCSA-N |
| XLogP | 3.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|