C3H7N5O3 — CID 137272272
4-amino-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide;hydrate (PubChem CID 137272272) has the molecular formula C3H7N5O3 and a molecular weight of 161.12 g/mol. Its IUPAC name is 4-amino-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide;hydrate.
| Compound Name | 4-amino-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide;hydrate |
|---|---|
| PubChem CID | 137272272 |
| Molecular Formula | C3H7N5O3 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 4-amino-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide;hydrate |
| SMILES | N/C(=N/O)c1nonc1N.O |
| InChI | InChI=1S/C3H5N5O2.H2O/c4-2(6-9)1-3(5)8-10-7-1;/h9H,(H2,4,6)(H2,5,8);1H2 |
| InChIKey | GASKVCSPWWEGEU-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|