C4H6N4O2 — CID 136954150
(Z)-2-amino-2-(4-amino-1,2,5-oxadiazol-3-yl)ethenol (PubChem CID 136954150) has the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. Its IUPAC name is (Z)-2-amino-2-(4-amino-1,2,5-oxadiazol-3-yl)ethenol.
| Compound Name | (Z)-2-amino-2-(4-amino-1,2,5-oxadiazol-3-yl)ethenol |
|---|---|
| PubChem CID | 136954150 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (Z)-2-amino-2-(4-amino-1,2,5-oxadiazol-3-yl)ethenol |
| SMILES | N/C(=C\O)c1nonc1N |
| InChI | InChI=1S/C4H6N4O2/c5-2(1-9)3-4(6)8-10-7-3/h1,9H,5H2,(H2,6,8)/b2-1- |
| InChIKey | ZULOKGNTSHDETJ-UPHRSURJSA-N |
| XLogP | -0.53 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|