C5H8N6O3 — CID 5363180
2-[(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxyacetamide (PubChem CID 5363180) has the molecular formula C5H8N6O3 and a molecular weight of 200.16 g/mol. Its IUPAC name is 2-[(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxyacetamide.
| Compound Name | 2-[(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 5363180 |
| Molecular Formula | C5H8N6O3 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-[(E)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxyacetamide |
| SMILES | NC(=O)CO/N=C(/N)c1nonc1N |
| InChI | InChI=1S/C5H8N6O3/c6-2(12)1-13-10-4(7)3-5(8)11-14-9-3/h1H2,(H2,6,12)(H2,7,10)(H2,8,11) |
| InChIKey | MKYIEXCIKRHPIM-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|