C12H16N6O5 — CID 172946795
[4-[3-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-2-oxopropyl]phenyl]-oxidoazanium;hydrate (PubChem CID 172946795) has the molecular formula C12H16N6O5 and a molecular weight of 324.30 g/mol. Its IUPAC name is [4-[3-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-2-oxopropyl]phenyl]-oxidoazanium;hydrate.
| Compound Name | [4-[3-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-2-oxopropyl]phenyl]-oxidoazanium;hydrate |
|---|---|
| PubChem CID | 172946795 |
| Molecular Formula | C12H16N6O5 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [4-[3-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-2-oxopropyl]phenyl]-oxidoazanium;hydrate |
| SMILES | N/C(=N\OCC(=O)Cc1ccc([NH2+][O-])cc1)c1nonc1N.O |
| InChI | InChI=1S/C12H14N6O4.H2O/c13-11(10-12(14)18-22-16-10)17-21-6-9(19)5-7-1-3-8(15-20)4-2-7;/h1-4H,5-6,15H2,(H2,13,17)(H2,14,18);1H2 |
| InChIKey | HXDXQKVCYQPION-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 200.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|