C17H14BrN7O4 — CID 131666234
4-amino-N'-[(E)-[2-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 131666234) has the molecular formula C17H14BrN7O4 and a molecular weight of 460.25 g/mol. Its IUPAC name is 4-amino-N'-[(E)-[2-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(E)-[2-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 131666234 |
| Molecular Formula | C17H14BrN7O4 |
| Molecular Weight | 460.25 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 4-amino-N'-[(E)-[2-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NC(=N/N=C/c1cc([N+](=O)[O-])ccc1OCc1ccc(Br)cc1)c1nonc1N |
| InChI | InChI=1S/C17H14BrN7O4/c18-12-3-1-10(2-4-12)9-28-14-6-5-13(25(26)27)7-11(14)8-21-22-16(19)15-17(20)24-29-23-15/h1-8H,9H2,(H2,19,22)(H2,20,24)/b21-8+ |
| InChIKey | KKLDGWABWBRDHI-ODCIPOBUSA-N |
| XLogP | 2.64 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|