C18H17N9O5 — CID 3623203
4-amino-N'-[[3-ethoxy-4-hydroxy-5-[(3-nitrophenyl)diazenyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 3623203) has the molecular formula C18H17N9O5 and a molecular weight of 439.39 g/mol. Its IUPAC name is 4-amino-N'-[[3-ethoxy-4-hydroxy-5-[(3-nitrophenyl)diazenyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[[3-ethoxy-4-hydroxy-5-[(3-nitrophenyl)diazenyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 3623203 |
| Molecular Formula | C18H17N9O5 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-amino-N'-[[3-ethoxy-4-hydroxy-5-[(3-nitrophenyl)diazenyl]phenyl]methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCOc1cc(C=NN=C(N)c2nonc2N)cc(/N=N/c2cccc([N+](=O)[O-])c2)c1O |
| InChI | InChI=1S/C18H17N9O5/c1-2-31-14-7-10(9-21-24-17(19)15-18(20)26-32-25-15)6-13(16(14)28)23-22-11-4-3-5-12(8-11)27(29)30/h3-9,28H,2H2,1H3,(H2,19,24)(H2,20,26)/b21-9?,23-22+ |
| InChIKey | KABKEHALWKXJLJ-PCAVJFJJSA-N |
| XLogP | 2.82 |
| TPSA | 213.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|