C5H8N6O3 — CID 45075997
2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethylamino]oxyacetamide (PubChem CID 45075997) has the molecular formula C5H8N6O3 and a molecular weight of 200.16 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethylamino]oxyacetamide.
| Compound Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethylamino]oxyacetamide |
|---|---|
| PubChem CID | 45075997 |
| Molecular Formula | C5H8N6O3 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazol-3-yl)iminomethylamino]oxyacetamide |
| SMILES | NC(=O)CON/C=N/c1nonc1N |
| InChI | InChI=1S/C5H8N6O3/c6-3(12)1-13-9-2-8-5-4(7)10-14-11-5/h2H,1H2,(H2,6,12)(H2,7,10)(H,8,9,11) |
| InChIKey | WUOBTSLVJYFPPB-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|