C13H16N6O3 — CID 12004874
2-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-N-(3,4-dimethylphenyl)acetamide (PubChem CID 12004874) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 12004874 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[(Z)-[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]oxy-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CO/N=C(\N)c2nonc2N)cc1C |
| InChI | InChI=1S/C13H16N6O3/c1-7-3-4-9(5-8(7)2)16-10(20)6-21-18-12(14)11-13(15)19-22-17-11/h3-5H,6H2,1-2H3,(H2,14,18)(H2,15,19)(H,16,20) |
| InChIKey | XYMWABMBRKSZOK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|