C11H12N4O4 — CID 17085500
4-amino-N-(3,4-dimethoxyphenyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 17085500) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 4-amino-N-(3,4-dimethoxyphenyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(3,4-dimethoxyphenyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 17085500 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-amino-N-(3,4-dimethoxyphenyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2nonc2N)cc1OC |
| InChI | InChI=1S/C11H12N4O4/c1-17-7-4-3-6(5-8(7)18-2)13-11(16)9-10(12)15-19-14-9/h3-5H,1-2H3,(H2,12,15)(H,13,16) |
| InChIKey | PTSYYGFVIYPNIT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |