C11H13N5O3 — CID 110484954
5-amino-N-(3,4-dimethoxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 110484954) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 5-amino-N-(3,4-dimethoxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-amino-N-(3,4-dimethoxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110484954 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 5-amino-N-(3,4-dimethoxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2n[nH]nc2N)cc1OC |
| InChI | InChI=1S/C11H13N5O3/c1-18-7-4-3-6(5-8(7)19-2)13-11(17)9-10(12)15-16-14-9/h3-5H,1-2H3,(H,13,17)(H3,12,14,15,16) |
| InChIKey | OKTJIZSSTXTKRN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |