C19H22N2O7 — CID 55744161
N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2,4,5-trimethoxybenzamide (PubChem CID 55744161) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 55744161 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccc(OC)c(OCC(N)=O)c2)cc1OC |
| InChI | InChI=1S/C19H22N2O7/c1-24-13-6-5-11(7-17(13)28-10-18(20)22)21-19(23)12-8-15(26-3)16(27-4)9-14(12)25-2/h5-9H,10H2,1-4H3,(H2,20,22)(H,21,23) |
| InChIKey | YYDACJHHXYNBGG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |