C4H7N5O2 — CID 142416542
N'-hydroxy-4-(methylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142416542) has the molecular formula C4H7N5O2 and a molecular weight of 157.13 g/mol. Its IUPAC name is N'-hydroxy-4-(methylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-hydroxy-4-(methylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142416542 |
| Molecular Formula | C4H7N5O2 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | N'-hydroxy-4-(methylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CNc1nonc1/C(N)=N/O |
| InChI | InChI=1S/C4H7N5O2/c1-6-4-2(3(5)7-10)8-11-9-4/h10H,1H3,(H2,5,7)(H,6,9) |
| InChIKey | UQOHNPBIYPEPPW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|