C5H10N6O4S — CID 140518115
N'-hydroxy-4-[(methylsulfamoylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 140518115) has the molecular formula C5H10N6O4S and a molecular weight of 250.24 g/mol. Its IUPAC name is N'-hydroxy-4-[(methylsulfamoylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-hydroxy-4-[(methylsulfamoylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 140518115 |
| Molecular Formula | C5H10N6O4S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | N'-hydroxy-4-[(methylsulfamoylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CNS(=O)(=O)NCc1nonc1/C(N)=N/O |
| InChI | InChI=1S/C5H10N6O4S/c1-7-16(13,14)8-2-3-4(5(6)9-12)11-15-10-3/h7-8,12H,2H2,1H3,(H2,6,9) |
| InChIKey | LDCXXOMRBHCPIA-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|