C8H18N6O4S — CID 142298399
ethane;N'-hydroxy-4-[[(2S)-2-sulfinamoyloxypropyl]amino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142298399) has the molecular formula C8H18N6O4S and a molecular weight of 294.34 g/mol. Its IUPAC name is ethane;N'-hydroxy-4-[[(2S)-2-sulfinamoyloxypropyl]amino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | ethane;N'-hydroxy-4-[[(2S)-2-sulfinamoyloxypropyl]amino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142298399 |
| Molecular Formula | C8H18N6O4S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | ethane;N'-hydroxy-4-[[(2S)-2-sulfinamoyloxypropyl]amino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC.C[C@@H](CNc1nonc1/C(N)=N/O)OS(N)=O |
| InChI | InChI=1S/C6H12N6O4S.C2H6/c1-3(15-17(8)14)2-9-6-4(5(7)10-13)11-16-12-6;1-2/h3,13H,2,8H2,1H3,(H2,7,10)(H,9,12);1-2H3/t3-,17?;/m0./s1 |
| InChIKey | AACAGAMUTWILLS-YGNXNPITSA-N |
| XLogP | -0.46 |
| TPSA | 161.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|