C6H8N8O9 — CID 102100574
3-N,4-N-bis(2,2-dinitroethyl)-1,2,5-oxadiazole-3,4-diamine (PubChem CID 102100574) has the molecular formula C6H8N8O9 and a molecular weight of 336.18 g/mol. Its IUPAC name is 3-N,4-N-bis(2,2-dinitroethyl)-1,2,5-oxadiazole-3,4-diamine.
| Compound Name | 3-N,4-N-bis(2,2-dinitroethyl)-1,2,5-oxadiazole-3,4-diamine |
|---|---|
| PubChem CID | 102100574 |
| Molecular Formula | C6H8N8O9 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 3-N,4-N-bis(2,2-dinitroethyl)-1,2,5-oxadiazole-3,4-diamine |
| SMILES | O=[N+]([O-])C(CNc1nonc1NCC([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N8O9/c15-11(16)3(12(17)18)1-7-5-6(10-23-9-5)8-2-4(13(19)20)14(21)22/h3-4H,1-2H2,(H,7,9)(H,8,10) |
| InChIKey | XTWJNSKRXKKVCA-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 235.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|