C10H14N12O12+2 — CID 100626261
(1,3-dihydroxy-2-nitropropan-2-yl)-[[4-[[4-[[(1,3-dihydroxy-2-nitropropan-2-yl)-oxoazaniumyl]amino]-1,2,5-oxadiazol-3-yl]diazenyl]-1,2,5-oxadiazol-3-yl]amino]-oxoazanium (PubChem CID 100626261) has the molecular formula C10H14N12O12+2 and a molecular weight of 494.29 g/mol. Its IUPAC name is (1,3-dihydroxy-2-nitropropan-2-yl)-[[4-[[4-[[(1,3-dihydroxy-2-nitropropan-2-yl)-oxoazaniumyl]amino]-1,2,5-oxadiazol-3-yl]diazenyl]-1,2,5-oxadiazol-3-yl]amino]-oxoazanium.
| Compound Name | (1,3-dihydroxy-2-nitropropan-2-yl)-[[4-[[4-[[(1,3-dihydroxy-2-nitropropan-2-yl)-oxoazaniumyl]amino]-1,2,5-oxadiazol-3-yl]diazenyl]-1,2,5-oxadiazol-3-yl]amino]-oxoazanium |
|---|---|
| PubChem CID | 100626261 |
| Molecular Formula | C10H14N12O12+2 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (1,3-dihydroxy-2-nitropropan-2-yl)-[[4-[[4-[[(1,3-dihydroxy-2-nitropropan-2-yl)-oxoazaniumyl]amino]-1,2,5-oxadiazol-3-yl]diazenyl]-1,2,5-oxadiazol-3-yl]amino]-oxoazanium |
| SMILES | O=[N+]([O-])C(CO)(CO)[N+](=O)Nc1nonc1/N=N/c1nonc1N[N+](=O)C(CO)(CO)[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N12O12/c23-1-9(2-24,21(29)30)19(27)13-7-5(15-33-17-7)11-12-6-8(18-34-16-6)14-20(28)10(3-25,4-26)22(31)32/h23-26H,1-4H2,(H,13,17,27)(H,14,18,28)/q+2/b12-11+ |
| InChIKey | CKFRLTMGLAJSMY-VAWYXSNFSA-N |
| XLogP | -3.01 |
| TPSA | 333.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|