C7H13N5O3S — CID 142416532
N'-hydroxy-4-(3-methylsulfinylpropylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142416532) has the molecular formula C7H13N5O3S and a molecular weight of 247.28 g/mol. Its IUPAC name is N'-hydroxy-4-(3-methylsulfinylpropylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-hydroxy-4-(3-methylsulfinylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142416532 |
| Molecular Formula | C7H13N5O3S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N'-hydroxy-4-(3-methylsulfinylpropylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)CCCNc1nonc1/C(N)=N/O |
| InChI | InChI=1S/C7H13N5O3S/c1-16(14)4-2-3-9-7-5(6(8)10-13)11-15-12-7/h13H,2-4H2,1H3,(H2,8,10)(H,9,12) |
| InChIKey | LWWWMTNBTYUILE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|