C6H12N6O2S — CID 142416522
4-(3-aminosulfanylpropylamino)-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142416522) has the molecular formula C6H12N6O2S and a molecular weight of 232.27 g/mol. Its IUPAC name is 4-(3-aminosulfanylpropylamino)-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(3-aminosulfanylpropylamino)-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142416522 |
| Molecular Formula | C6H12N6O2S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(3-aminosulfanylpropylamino)-N'-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NSCCCNc1nonc1/C(N)=N\O |
| InChI | InChI=1S/C6H12N6O2S/c7-5(10-13)4-6(12-14-11-4)9-2-1-3-15-8/h13H,1-3,8H2,(H2,7,10)(H,9,12) |
| InChIKey | ORGWSFSWDYFSAJ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|