C14H17BrFN5OS — CID 134454458
N'-[(3-bromo-4-fluorophenyl)methyl]-4-(2-ethylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 134454458) has the molecular formula C14H17BrFN5OS and a molecular weight of 402.29 g/mol. Its IUPAC name is N'-[(3-bromo-4-fluorophenyl)methyl]-4-(2-ethylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(3-bromo-4-fluorophenyl)methyl]-4-(2-ethylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 134454458 |
| Molecular Formula | C14H17BrFN5OS |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N'-[(3-bromo-4-fluorophenyl)methyl]-4-(2-ethylsulfanylethylamino)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCSCCNc1nonc1/C(N)=N/Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H17BrFN5OS/c1-2-23-6-5-18-14-12(20-22-21-14)13(17)19-8-9-3-4-11(16)10(15)7-9/h3-4,7H,2,5-6,8H2,1H3,(H2,17,19)(H,18,21) |
| InChIKey | USSGKKGQUPEWGO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|