C16H22BrFN5O+ — CID 163854672
(3-bromo-4-fluorophenyl)-[C-[4-(butylamino)-1,2,5-oxadiazol-3-yl]-N-methylcarbonimidoyl]-dimethylazanium (PubChem CID 163854672) has the molecular formula C16H22BrFN5O+ and a molecular weight of 399.29 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)-[C-[4-(butylamino)-1,2,5-oxadiazol-3-yl]-N-methylcarbonimidoyl]-dimethylazanium.
| Compound Name | (3-bromo-4-fluorophenyl)-[C-[4-(butylamino)-1,2,5-oxadiazol-3-yl]-N-methylcarbonimidoyl]-dimethylazanium |
|---|---|
| PubChem CID | 163854672 |
| Molecular Formula | C16H22BrFN5O+ |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (3-bromo-4-fluorophenyl)-[C-[4-(butylamino)-1,2,5-oxadiazol-3-yl]-N-methylcarbonimidoyl]-dimethylazanium |
| SMILES | CCCCNc1nonc1/C(=N\C)[N+](C)(C)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C16H22BrFN5O/c1-5-6-9-20-15-14(21-24-22-15)16(19-2)23(3,4)11-7-8-13(18)12(17)10-11/h7-8,10H,5-6,9H2,1-4H3,(H,20,22)/q+1/b19-16+ |
| InChIKey | PLPHZIDHAVWAHD-KNTRCKAVSA-N |
| XLogP | 3.83 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|