C13H15BrFN5O2 — CID 163537139
N-(3-bromo-4-fluorophenyl)-4-(2-methoxyethylamino)-N'-methyl-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 163537139) has the molecular formula C13H15BrFN5O2 and a molecular weight of 372.20 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-4-(2-methoxyethylamino)-N'-methyl-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-4-(2-methoxyethylamino)-N'-methyl-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 163537139 |
| Molecular Formula | C13H15BrFN5O2 |
| Molecular Weight | 372.20 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-4-(2-methoxyethylamino)-N'-methyl-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | C/N=C(/Nc1ccc(F)c(Br)c1)c1nonc1NCCOC |
| InChI | InChI=1S/C13H15BrFN5O2/c1-16-12(18-8-3-4-10(15)9(14)7-8)11-13(20-22-19-11)17-5-6-21-2/h3-4,7H,5-6H2,1-2H3,(H,16,18)(H,17,20) |
| InChIKey | KFIZRMQKKPZZKF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|