C14H19BrFN7O3S — CID 137306209
N'-(3-bromo-4-fluorophenyl)-4-[2-[(S-ethyl-N-methylsulfonimidoyl)amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137306209) has the molecular formula C14H19BrFN7O3S and a molecular weight of 464.32 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-[(S-ethyl-N-methylsulfonimidoyl)amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[(S-ethyl-N-methylsulfonimidoyl)amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137306209 |
| Molecular Formula | C14H19BrFN7O3S |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[(S-ethyl-N-methylsulfonimidoyl)amino]ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCS(=O)(=NC)NCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C14H19BrFN7O3S/c1-3-27(25,17-2)19-7-6-18-13-12(22-26-23-13)14(21-24)20-9-4-5-11(16)10(15)8-9/h4-5,8,24H,3,6-7H2,1-2H3,(H,18,23)(H,20,21)(H,17,19,25) |
| InChIKey | FPHIIFMLBYXEOQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|