C19H21BrFN7O5S2 — CID 137245055
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[S-methyl-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137245055) has the molecular formula C19H21BrFN7O5S2 and a molecular weight of 590.46 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[S-methyl-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[S-methyl-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137245055 |
| Molecular Formula | C19H21BrFN7O5S2 |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 589.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[S-methyl-N-(4-methylphenyl)sulfonylsulfonimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(C)(=O)NCCNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)cc1 |
| InChI | InChI=1S/C19H21BrFN7O5S2/c1-12-3-6-14(7-4-12)35(31,32)28-34(2,30)23-10-9-22-18-17(26-33-27-18)19(25-29)24-13-5-8-16(21)15(20)11-13/h3-8,11,29H,9-10H2,1-2H3,(H,22,27)(H,24,25)(H,23,28,30) |
| InChIKey | UBUZCDWGOWDITA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 171.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|