C14H15BrF4N8O — CID 137419586
N'-(3-bromo-4-fluorophenyl)-4-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137419586) has the molecular formula C14H15BrF4N8O and a molecular weight of 467.23 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137419586 |
| Molecular Formula | C14H15BrF4N8O |
| Molecular Weight | 467.23 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1ccc(F)c(Br)c1)c1nonc1NCCN/C(N)=N/CC(F)(F)F |
| InChI | InChI=1S/C14H15BrF4N8O/c15-8-5-7(1-2-9(8)16)25-11(20)10-12(27-28-26-10)22-3-4-23-13(21)24-6-14(17,18)19/h1-2,5H,3-4,6H2,(H2,20,25)(H,22,27)(H3,21,23,24) |
| InChIKey | CCNQJDIPYWFWCM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|