C17H12BrFN6O — CID 89304848
N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 89304848) has the molecular formula C17H12BrFN6O and a molecular weight of 415.23 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 89304848 |
| Molecular Formula | C17H12BrFN6O |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N#Cc1cccc(CNc2nonc2/C(N)=N/c2ccc(F)c(Br)c2)c1 |
| InChI | InChI=1S/C17H12BrFN6O/c18-13-7-12(4-5-14(13)19)23-16(21)15-17(25-26-24-15)22-9-11-3-1-2-10(6-11)8-20/h1-7H,9H2,(H2,21,23)(H,22,25) |
| InChIKey | MCVZEOVODWIZAF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|