C18H12FN7O2 — CID 135510760
N'-(3-cyano-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135510760) has the molecular formula C18H12FN7O2 and a molecular weight of 377.34 g/mol. Its IUPAC name is N'-(3-cyano-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-cyano-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135510760 |
| Molecular Formula | C18H12FN7O2 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N'-(3-cyano-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N#Cc1cccc(CNc2nonc2/C(=N/c2ccc(F)c(C#N)c2)NO)c1 |
| InChI | InChI=1S/C18H12FN7O2/c19-15-5-4-14(7-13(15)9-21)23-18(24-27)16-17(26-28-25-16)22-10-12-3-1-2-11(6-12)8-20/h1-7,27H,10H2,(H,22,26)(H,23,24) |
| InChIKey | LQPADWUNPVPUBZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 143.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|