C17H12BrFN6O2 — CID 135424923
N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135424923) has the molecular formula C17H12BrFN6O2 and a molecular weight of 431.23 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135424923 |
| Molecular Formula | C17H12BrFN6O2 |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[(3-cyanophenyl)methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N#Cc1cccc(CNc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)c1 |
| InChI | InChI=1S/C17H12BrFN6O2/c18-13-7-12(4-5-14(13)19)22-17(23-26)15-16(25-27-24-15)21-9-11-3-1-2-10(6-11)8-20/h1-7,26H,9H2,(H,21,25)(H,22,23) |
| InChIKey | OASYAUFFEVXYNZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|