C27H27BrF7N7O4 — CID 159551541
N'-(3-bromo-4-fluorophenyl)-4-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159551541) has the molecular formula C27H27BrF7N7O4 and a molecular weight of 726.45 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159551541 |
| Molecular Formula | C27H27BrF7N7O4 |
| Molecular Weight | 726.45 g/mol |
| Exact Mass | 725.12 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | CCN1CCN(Cc2ccc(CNc3nonc3/C(=N/c3ccc(F)c(Br)c3)NO)cc2)CC1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H27BrFN7O2.C4F6O2/c1-2-31-9-11-32(12-10-31)15-17-5-3-16(4-6-17)14-26-22-21(29-34-30-22)23(28-33)27-18-7-8-20(25)19(24)13-18;5-3(6,7)1(11)2(12)4(8,9)10/h3-8,13,33H,2,9-12,14-15H2,1H3,(H,26,30)(H,27,28); |
| InChIKey | MFLLXLNIUZFNBR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|