C17H20BrFN8O3 — CID 146427736
N-[N'-[3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]cyclopropanecarboxamide (PubChem CID 146427736) has the molecular formula C17H20BrFN8O3 and a molecular weight of 483.30 g/mol. Its IUPAC name is N-[N'-[3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]cyclopropanecarboxamide.
| Compound Name | N-[N'-[3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 146427736 |
| Molecular Formula | C17H20BrFN8O3 |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[N'-[3-[[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]cyclopropanecarboxamide |
| SMILES | N/C(=N\CCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)NC(=O)C1CC1 |
| InChI | InChI=1S/C17H20BrFN8O3/c18-11-8-10(4-5-12(11)19)23-15(25-29)13-14(27-30-26-13)21-6-1-7-22-17(20)24-16(28)9-2-3-9/h4-5,8-9,29H,1-3,6-7H2,(H,21,27)(H,23,25)(H3,20,22,24,28) |
| InChIKey | BHKLBVCVMBQMNW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 163.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|