C21H30BrFN8O3 — CID 170343376
4-[3-[[amino-[(1-cyclopentyl-2-hydroxypropan-2-yl)amino]methylidene]amino]propylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 170343376) has the molecular formula C21H30BrFN8O3 and a molecular weight of 541.43 g/mol. Its IUPAC name is 4-[3-[[amino-[(1-cyclopentyl-2-hydroxypropan-2-yl)amino]methylidene]amino]propylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[3-[[amino-[(1-cyclopentyl-2-hydroxypropan-2-yl)amino]methylidene]amino]propylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 170343376 |
| Molecular Formula | C21H30BrFN8O3 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 4-[3-[[amino-[(1-cyclopentyl-2-hydroxypropan-2-yl)amino]methylidene]amino]propylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(O)(CC1CCCC1)N/C(N)=N/CCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C21H30BrFN8O3/c1-21(32,12-13-5-2-3-6-13)28-20(24)26-10-4-9-25-18-17(30-34-31-18)19(29-33)27-14-7-8-16(23)15(22)11-14/h7-8,11,13,32-33H,2-6,9-10,12H2,1H3,(H,25,31)(H,27,29)(H3,24,26,28) |
| InChIKey | NICOSGPWPMTGQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 166.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|