C16H20BrFN6O4S — CID 163498718
N'-(3-bromo-4-fluorophenyl)-4-[2-(cyclopentylsulfamoyl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 163498718) has the molecular formula C16H20BrFN6O4S and a molecular weight of 491.34 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[2-(cyclopentylsulfamoyl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[2-(cyclopentylsulfamoyl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 163498718 |
| Molecular Formula | C16H20BrFN6O4S |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[2-(cyclopentylsulfamoyl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S(=O)(CCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)NC1CCCC1 |
| InChI | InChI=1S/C16H20BrFN6O4S/c17-12-9-11(5-6-13(12)18)20-16(21-25)14-15(23-28-22-14)19-7-8-29(26,27)24-10-3-1-2-4-10/h5-6,9-10,24-25H,1-4,7-8H2,(H,19,23)(H,20,21) |
| InChIKey | CSWYHGAILOHCGJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|