C15H20BrFN8O4S — CID 137419399
4-[2-[[amino-(propan-2-ylsulfonylamino)methylidene]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137419399) has the molecular formula C15H20BrFN8O4S and a molecular weight of 507.35 g/mol. Its IUPAC name is 4-[2-[[amino-(propan-2-ylsulfonylamino)methylidene]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[2-[[amino-(propan-2-ylsulfonylamino)methylidene]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137419399 |
| Molecular Formula | C15H20BrFN8O4S |
| Molecular Weight | 507.35 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 4-[2-[[amino-(propan-2-ylsulfonylamino)methylidene]amino]ethylamino]-N'-(3-bromo-4-fluorophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(C)S(=O)(=O)N/C(N)=N/CCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C15H20BrFN8O4S/c1-8(2)30(27,28)25-15(18)20-6-5-19-13-12(23-29-24-13)14(22-26)21-9-3-4-11(17)10(16)7-9/h3-4,7-8,26H,5-6H2,1-2H3,(H,19,24)(H,21,22)(H3,18,20,25) |
| InChIKey | GZWGCYYVUBMJSV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 180.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|