C22H24BrFN8O3 — CID 160631855
N-[N'-[3-[[4-[N'-(3-bromo-4-methylphenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide (PubChem CID 160631855) has the molecular formula C22H24BrFN8O3 and a molecular weight of 547.39 g/mol. Its IUPAC name is N-[N'-[3-[[4-[N'-(3-bromo-4-methylphenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[N'-[3-[[4-[N'-(3-bromo-4-methylphenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 160631855 |
| Molecular Formula | C22H24BrFN8O3 |
| Molecular Weight | 547.39 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | N-[N'-[3-[[4-[N'-(3-bromo-4-methylphenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]propyl]carbamimidoyl]-2-(4-fluorophenyl)acetamide |
| SMILES | Cc1ccc(/N=C(\NO)c2nonc2NCCC/N=C(\N)NC(=O)Cc2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C22H24BrFN8O3/c1-13-3-8-16(12-17(13)23)28-21(30-34)19-20(32-35-31-19)26-9-2-10-27-22(25)29-18(33)11-14-4-6-15(24)7-5-14/h3-8,12,34H,2,9-11H2,1H3,(H,26,32)(H,28,30)(H3,25,27,29,33) |
| InChIKey | WBTNXYZSWKLZLK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 163.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|