C13H12FN5O3S — CID 137217301
N'-(3-cyano-4-fluorophenyl)-N-hydroxy-4-(3-hydroxypropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137217301) has the molecular formula C13H12FN5O3S and a molecular weight of 337.34 g/mol. Its IUPAC name is N'-(3-cyano-4-fluorophenyl)-N-hydroxy-4-(3-hydroxypropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-cyano-4-fluorophenyl)-N-hydroxy-4-(3-hydroxypropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137217301 |
| Molecular Formula | C13H12FN5O3S |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N'-(3-cyano-4-fluorophenyl)-N-hydroxy-4-(3-hydroxypropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N#Cc1cc(/N=C(\NO)c2nonc2SCCCO)ccc1F |
| InChI | InChI=1S/C13H12FN5O3S/c14-10-3-2-9(6-8(10)7-15)16-12(17-21)11-13(19-22-18-11)23-5-1-4-20/h2-3,6,20-21H,1,4-5H2,(H,16,17) |
| InChIKey | YPCKKVOQIIJSME-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|