C12H10BrFN4O3S — CID 137223064
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxopropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137223064) has the molecular formula C12H10BrFN4O3S and a molecular weight of 389.21 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxopropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxopropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137223064 |
| Molecular Formula | C12H10BrFN4O3S |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(2-oxopropylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(=O)CSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C12H10BrFN4O3S/c1-6(19)5-22-12-10(17-21-18-12)11(16-20)15-7-2-3-9(14)8(13)4-7/h2-4,20H,5H2,1H3,(H,15,16) |
| InChIKey | HSVZCAORNDWMKI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|