C14H14BrFN4O4 — CID 158061534
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(4-oxopentoxy)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 158061534) has the molecular formula C14H14BrFN4O4 and a molecular weight of 401.19 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(4-oxopentoxy)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(4-oxopentoxy)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 158061534 |
| Molecular Formula | C14H14BrFN4O4 |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(4-oxopentoxy)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(=O)CCCOc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C14H14BrFN4O4/c1-8(21)3-2-6-23-14-12(19-24-20-14)13(18-22)17-9-4-5-11(16)10(15)7-9/h4-5,7,22H,2-3,6H2,1H3,(H,17,18) |
| InChIKey | FKSCFTZCLLBWDY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|