C17H25FN6O3 — CID 158692010
4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 158692010) has the molecular formula C17H25FN6O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 158692010 |
| Molecular Formula | C17H25FN6O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1cc(/N=C(\NO)c2nonc2OCCN(C)CCN(C)C)ccc1F |
| InChI | InChI=1S/C17H25FN6O3/c1-12-11-13(5-6-14(12)18)19-16(20-25)15-17(22-27-21-15)26-10-9-24(4)8-7-23(2)3/h5-6,11,25H,7-10H2,1-4H3,(H,19,20) |
| InChIKey | MEKAEUHPWIEHMU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|