C17H22FN5O3 — CID 158752739
4-[(4-aminocyclohexyl)oxymethyl]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 158752739) has the molecular formula C17H22FN5O3 and a molecular weight of 363.39 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)oxymethyl]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[(4-aminocyclohexyl)oxymethyl]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 158752739 |
| Molecular Formula | C17H22FN5O3 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-[(4-aminocyclohexyl)oxymethyl]-N'-(4-fluoro-3-methylphenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1cc(/N=C(\NO)c2nonc2COC2CCC(N)CC2)ccc1F |
| InChI | InChI=1S/C17H22FN5O3/c1-10-8-12(4-7-14(10)18)20-17(21-24)16-15(22-26-23-16)9-25-13-5-2-11(19)3-6-13/h4,7-8,11,13,24H,2-3,5-6,9,19H2,1H3,(H,20,21) |
| InChIKey | GNMVLQQGPZHHLJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|