C12H15FN6O5S2 — CID 157479978
N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfinyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 157479978) has the molecular formula C12H15FN6O5S2 and a molecular weight of 406.42 g/mol. Its IUPAC name is N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfinyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfinyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 157479978 |
| Molecular Formula | C12H15FN6O5S2 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N'-(4-fluoro-3-methylphenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfinyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1cc(/N=C(\NO)c2nonc2S(=O)CCNS(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H15FN6O5S2/c1-7-6-8(2-3-9(7)13)16-11(17-20)10-12(19-24-18-10)25(21)5-4-15-26(14,22)23/h2-3,6,15,20H,4-5H2,1H3,(H,16,17)(H2,14,22,23) |
| InChIKey | HNNWWYZMYSIXPF-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 172.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|