C15H12ClFN6O4S — CID 139521175
4-[2-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]ethylsulfinyl]-N'-(3-chloro-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139521175) has the molecular formula C15H12ClFN6O4S and a molecular weight of 426.82 g/mol. Its IUPAC name is 4-[2-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]ethylsulfinyl]-N'-(3-chloro-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[2-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]ethylsulfinyl]-N'-(3-chloro-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139521175 |
| Molecular Formula | C15H12ClFN6O4S |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 4-[2-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]ethylsulfinyl]-N'-(3-chloro-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1ccc(F)c(Cl)c1)c1nonc1S(=O)CCNc1c(N)c(=O)c1=O |
| InChI | InChI=1S/C15H12ClFN6O4S/c16-7-5-6(1-2-8(7)17)21-14(19)11-15(23-27-22-11)28(26)4-3-20-10-9(18)12(24)13(10)25/h1-2,5,20H,3-4,18H2,(H2,19,21) |
| InChIKey | DDKBKRTYLUEWIX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|