C11H8ClFN8O — CID 89342612
N'-(3-chloro-4-fluorophenyl)-4-(tetrazol-1-ylmethyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 89342612) has the molecular formula C11H8ClFN8O and a molecular weight of 322.69 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-(tetrazol-1-ylmethyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-(tetrazol-1-ylmethyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 89342612 |
| Molecular Formula | C11H8ClFN8O |
| Molecular Weight | 322.69 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-(tetrazol-1-ylmethyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1ccc(F)c(Cl)c1)c1nonc1Cn1cnnn1 |
| InChI | InChI=1S/C11H8ClFN8O/c12-7-3-6(1-2-8(7)13)16-11(14)10-9(17-22-18-10)4-21-5-15-19-20-21/h1-3,5H,4H2,(H2,14,16) |
| InChIKey | SALZATWQABHJJO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.69 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|