C21H22ClFN6O2 — CID 89342625
N'-(3-chloro-4-fluorophenyl)-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 89342625) has the molecular formula C21H22ClFN6O2 and a molecular weight of 444.90 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 89342625 |
| Molecular Formula | C21H22ClFN6O2 |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | COc1ccccc1N1CCN(Cc2nonc2/C(N)=N/c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H22ClFN6O2/c1-30-19-5-3-2-4-18(19)29-10-8-28(9-11-29)13-17-20(27-31-26-17)21(24)25-14-6-7-16(23)15(22)12-14/h2-7,12H,8-11,13H2,1H3,(H2,24,25) |
| InChIKey | GNRPLUBLGDEGQB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|