C18H11ClF4N8O2 — CID 89342689
N'-(3-chloro-4-fluorophenyl)-4-[[5-[3-(trifluoromethoxy)phenyl]tetrazol-2-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 89342689) has the molecular formula C18H11ClF4N8O2 and a molecular weight of 482.79 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[[5-[3-(trifluoromethoxy)phenyl]tetrazol-2-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[[5-[3-(trifluoromethoxy)phenyl]tetrazol-2-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 89342689 |
| Molecular Formula | C18H11ClF4N8O2 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[[5-[3-(trifluoromethoxy)phenyl]tetrazol-2-yl]methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1ccc(F)c(Cl)c1)c1nonc1Cn1nnc(-c2cccc(OC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H11ClF4N8O2/c19-12-7-10(4-5-13(12)20)25-16(24)15-14(28-33-29-15)8-31-27-17(26-30-31)9-2-1-3-11(6-9)32-18(21,22)23/h1-7H,8H2,(H2,24,25) |
| InChIKey | NTMMPXQMLPFHHU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|