C14H15F3N6O5S2 — CID 139520948
2-sulfamoyl-N-[2-[[4-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]acetamide (PubChem CID 139520948) has the molecular formula C14H15F3N6O5S2 and a molecular weight of 468.44 g/mol. Its IUPAC name is 2-sulfamoyl-N-[2-[[4-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]acetamide.
| Compound Name | 2-sulfamoyl-N-[2-[[4-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 139520948 |
| Molecular Formula | C14H15F3N6O5S2 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-sulfamoyl-N-[2-[[4-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]acetamide |
| SMILES | N/C(=N\c1cccc(OC(F)(F)F)c1)c1nonc1SCCNC(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C14H15F3N6O5S2/c15-14(16,17)27-9-3-1-2-8(6-9)21-12(18)11-13(23-28-22-11)29-5-4-20-10(24)7-30(19,25)26/h1-3,6H,4-5,7H2,(H2,18,21)(H,20,24)(H2,19,25,26) |
| InChIKey | QPALWCJGMAWWLF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 175.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|