C17H19F3N6O2S — CID 139520666
N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-methylazetidine-2-carboxamide (PubChem CID 139520666) has the molecular formula C17H19F3N6O2S and a molecular weight of 428.44 g/mol. Its IUPAC name is N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-methylazetidine-2-carboxamide.
| Compound Name | N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-methylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 139520666 |
| Molecular Formula | C17H19F3N6O2S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-methylazetidine-2-carboxamide |
| SMILES | CC1(C(=O)NCCSc2nonc2/C(N)=N/c2ccc(F)c(C(F)F)c2)CCN1 |
| InChI | InChI=1S/C17H19F3N6O2S/c1-17(4-5-23-17)16(27)22-6-7-29-15-12(25-28-26-15)14(21)24-9-2-3-11(18)10(8-9)13(19)20/h2-3,8,13,23H,4-7H2,1H3,(H2,21,24)(H,22,27) |
| InChIKey | LKRZXNRHFAGTDY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|