C16H18F3N5O4S2 — CID 160519919
N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[5-(methylsulfonimidoyl)-4-oxopentyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 160519919) has the molecular formula C16H18F3N5O4S2 and a molecular weight of 465.48 g/mol. Its IUPAC name is N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[5-(methylsulfonimidoyl)-4-oxopentyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[5-(methylsulfonimidoyl)-4-oxopentyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 160519919 |
| Molecular Formula | C16H18F3N5O4S2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | N'-[3-(difluoromethyl)-4-fluorophenyl]-N-hydroxy-4-[5-(methylsulfonimidoyl)-4-oxopentyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)CC(=O)CCCSc1nonc1/C(=N/c1ccc(F)c(C(F)F)c1)NO |
| InChI | InChI=1S/C16H18F3N5O4S2/c1-30(20,27)8-10(25)3-2-6-29-16-13(23-28-24-16)15(22-26)21-9-4-5-12(17)11(7-9)14(18)19/h4-5,7,14,20,26H,2-3,6,8H2,1H3,(H,21,22) |
| InChIKey | QUDFYVSEIWUXLA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|