C13H15F3N6O2S2 — CID 139521212
N'-[3-(difluoromethyl)-4-fluorophenyl]-4-[2-[(methylsulfonimidoyl)amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139521212) has the molecular formula C13H15F3N6O2S2 and a molecular weight of 408.43 g/mol. Its IUPAC name is N'-[3-(difluoromethyl)-4-fluorophenyl]-4-[2-[(methylsulfonimidoyl)amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[3-(difluoromethyl)-4-fluorophenyl]-4-[2-[(methylsulfonimidoyl)amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139521212 |
| Molecular Formula | C13H15F3N6O2S2 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N'-[3-(difluoromethyl)-4-fluorophenyl]-4-[2-[(methylsulfonimidoyl)amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)NCCSc1nonc1/C(N)=N/c1ccc(F)c(C(F)F)c1 |
| InChI | InChI=1S/C13H15F3N6O2S2/c1-26(18,23)19-4-5-25-13-10(21-24-22-13)12(17)20-7-2-3-9(14)8(6-7)11(15)16/h2-3,6,11H,4-5H2,1H3,(H2,17,20)(H2,18,19,23) |
| InChIKey | CFUMJWJYTWVMTQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|