C19H18F2N6O4S2 — CID 139520653
N-[2-[[4-[N'-[3-(difluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-sulfamoylbenzamide (PubChem CID 139520653) has the molecular formula C19H18F2N6O4S2 and a molecular weight of 496.52 g/mol. Its IUPAC name is N-[2-[[4-[N'-[3-(difluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-sulfamoylbenzamide.
| Compound Name | N-[2-[[4-[N'-[3-(difluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 139520653 |
| Molecular Formula | C19H18F2N6O4S2 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | N-[2-[[4-[N'-[3-(difluoromethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-sulfamoylbenzamide |
| SMILES | N/C(=N\c1cccc(C(F)F)c1)c1nonc1SCCNC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H18F2N6O4S2/c20-16(21)12-2-1-3-13(10-12)25-17(22)15-19(27-31-26-15)32-9-8-24-18(28)11-4-6-14(7-5-11)33(23,29)30/h1-7,10,16H,8-9H2,(H2,22,25)(H,24,28)(H2,23,29,30) |
| InChIKey | FALPPKGYEYTWID-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|