C14H15FN6O3S — CID 137297500
2-[[4-[N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethylurea (PubChem CID 137297500) has the molecular formula C14H15FN6O3S and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-[[4-[N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethylurea.
| Compound Name | 2-[[4-[N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethylurea |
|---|---|
| PubChem CID | 137297500 |
| Molecular Formula | C14H15FN6O3S |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[[4-[N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethylurea |
| SMILES | NC(=O)NCCSc1nonc1/C(=N/C1Cc2c(F)cccc21)NO |
| InChI | InChI=1S/C14H15FN6O3S/c15-9-3-1-2-7-8(9)6-10(7)18-12(19-23)11-13(21-24-20-11)25-5-4-17-14(16)22/h1-3,10,23H,4-6H2,(H,18,19)(H3,16,17,22) |
| InChIKey | ONGVKPDIMCLPGC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|